C25H28N2 — CID 134513386
4-[1-[1-(4-cyclobutyl-2-methylphenyl)ethenyl]piperidin-4-yl]benzonitrile (PubChem CID 134513386) has the molecular formula C25H28N2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 4-[1-[1-(4-cyclobutyl-2-methylphenyl)ethenyl]piperidin-4-yl]benzonitrile.
| Compound Name | 4-[1-[1-(4-cyclobutyl-2-methylphenyl)ethenyl]piperidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 134513386 |
| Molecular Formula | C25H28N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 4-[1-[1-(4-cyclobutyl-2-methylphenyl)ethenyl]piperidin-4-yl]benzonitrile |
| SMILES | C=C(c1ccc(C2CCC2)cc1C)N1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C25H28N2/c1-18-16-24(21-4-3-5-21)10-11-25(18)19(2)27-14-12-23(13-15-27)22-8-6-20(17-26)7-9-22/h6-11,16,21,23H,2-5,12-15H2,1H3 |
| InChIKey | DRIYPRZHRHSEPA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |