C21H22N2 — CID 130216383
4-[1-[1-(4-methylphenyl)ethenyl]piperidin-4-yl]benzonitrile (PubChem CID 130216383) has the molecular formula C21H22N2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-[1-[1-(4-methylphenyl)ethenyl]piperidin-4-yl]benzonitrile.
| Compound Name | 4-[1-[1-(4-methylphenyl)ethenyl]piperidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 130216383 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 4-[1-[1-(4-methylphenyl)ethenyl]piperidin-4-yl]benzonitrile |
| SMILES | C=C(c1ccc(C)cc1)N1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C21H22N2/c1-16-3-7-19(8-4-16)17(2)23-13-11-21(12-14-23)20-9-5-18(15-22)6-10-20/h3-10,21H,2,11-14H2,1H3 |
| InChIKey | VFNXCFBCKWYTPO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |