C25H29N3O3 — CID 24988178
2-methylpropyl N-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]-4-methylphenyl]carbamate (PubChem CID 24988178) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-methylpropyl N-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]-4-methylphenyl]carbamate.
| Compound Name | 2-methylpropyl N-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]-4-methylphenyl]carbamate |
|---|---|
| PubChem CID | 24988178 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-methylpropyl N-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]-4-methylphenyl]carbamate |
| SMILES | Cc1ccc(NC(=O)OCC(C)C)cc1C(=O)N1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C25H29N3O3/c1-17(2)16-31-25(30)27-22-9-4-18(3)23(14-22)24(29)28-12-10-21(11-13-28)20-7-5-19(15-26)6-8-20/h4-9,14,17,21H,10-13,16H2,1-3H3,(H,27,30) |
| InChIKey | JGXIPXPVHCHQGM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |