C27H27N5O2 — CID 25132035
1-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]-4-methylphenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 25132035) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 1-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]-4-methylphenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]-4-methylphenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 25132035 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 1-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]-4-methylphenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | Cc1ccc(NC(=O)NCc2cccnc2)cc1C(=O)N1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C27H27N5O2/c1-19-4-9-24(31-27(34)30-18-21-3-2-12-29-17-21)15-25(19)26(33)32-13-10-23(11-14-32)22-7-5-20(16-28)6-8-22/h2-9,12,15,17,23H,10-11,13-14,18H2,1H3,(H2,30,31,34) |
| InChIKey | MGALCCYGRODJBM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |