C24H28N4O2S — CID 68954724
1-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]-4-methylsulfanylphenyl]-3-propan-2-ylurea (PubChem CID 68954724) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is 1-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]-4-methylsulfanylphenyl]-3-propan-2-ylurea.
| Compound Name | 1-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]-4-methylsulfanylphenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 68954724 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 1-[3-[4-(4-cyanophenyl)piperidine-1-carbonyl]-4-methylsulfanylphenyl]-3-propan-2-ylurea |
| SMILES | CSc1ccc(NC(=O)NC(C)C)cc1C(=O)N1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C24H28N4O2S/c1-16(2)26-24(30)27-20-8-9-22(31-3)21(14-20)23(29)28-12-10-19(11-13-28)18-6-4-17(15-25)5-7-18/h4-9,14,16,19H,10-13H2,1-3H3,(H2,26,27,30) |
| InChIKey | CLZSJCDBZOWKNR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |