C19H22N2O — CID 136536266
(2,5-dimethylphenyl)-(4-pyridin-4-ylpiperidin-1-yl)methanone (PubChem CID 136536266) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-(4-pyridin-4-ylpiperidin-1-yl)methanone.
| Compound Name | (2,5-dimethylphenyl)-(4-pyridin-4-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 136536266 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (2,5-dimethylphenyl)-(4-pyridin-4-ylpiperidin-1-yl)methanone |
| SMILES | Cc1ccc(C)c(C(=O)N2CCC(c3ccncc3)CC2)c1 |
| InChI | InChI=1S/C19H22N2O/c1-14-3-4-15(2)18(13-14)19(22)21-11-7-17(8-12-21)16-5-9-20-10-6-16/h3-6,9-10,13,17H,7-8,11-12H2,1-2H3 |
| InChIKey | SZGAXDYMEQKOJZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |