C20H23N3O2 — CID 110808553
[4-(2,5-dimethylbenzoyl)-1,4-diazepan-1-yl]-pyridin-4-ylmethanone (PubChem CID 110808553) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is [4-(2,5-dimethylbenzoyl)-1,4-diazepan-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [4-(2,5-dimethylbenzoyl)-1,4-diazepan-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 110808553 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | [4-(2,5-dimethylbenzoyl)-1,4-diazepan-1-yl]-pyridin-4-ylmethanone |
| SMILES | Cc1ccc(C)c(C(=O)N2CCCN(C(=O)c3ccncc3)CC2)c1 |
| InChI | InChI=1S/C20H23N3O2/c1-15-4-5-16(2)18(14-15)20(25)23-11-3-10-22(12-13-23)19(24)17-6-8-21-9-7-17/h4-9,14H,3,10-13H2,1-2H3 |
| InChIKey | IDYDSTYSMCYYEG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |