C21H24BClN2O3 — CID 146075433
1-[4-(4-chloroanilino)piperidin-1-yl]-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propan-1-one (PubChem CID 146075433) has the molecular formula C21H24BClN2O3 and a molecular weight of 398.70 g/mol. Its IUPAC name is 1-[4-(4-chloroanilino)piperidin-1-yl]-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propan-1-one.
| Compound Name | 1-[4-(4-chloroanilino)piperidin-1-yl]-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propan-1-one |
|---|---|
| PubChem CID | 146075433 |
| Molecular Formula | C21H24BClN2O3 |
| Molecular Weight | 398.70 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1-[4-(4-chloroanilino)piperidin-1-yl]-3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propan-1-one |
| SMILES | O=C(CCc1cccc2c1B(O)OC2)N1CCC(Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H24BClN2O3/c23-17-5-7-18(8-6-17)24-19-10-12-25(13-11-19)20(26)9-4-15-2-1-3-16-14-28-22(27)21(15)16/h1-3,5-8,19,24,27H,4,9-14H2 |
| InChIKey | BGIWSQBRVNCDCM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.70 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|