C13H17BO4 — CID 90459081
1-[(1-hydroxy-7-propyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one (PubChem CID 90459081) has the molecular formula C13H17BO4 and a molecular weight of 248.09 g/mol. Its IUPAC name is 1-[(1-hydroxy-7-propyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one.
| Compound Name | 1-[(1-hydroxy-7-propyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one |
|---|---|
| PubChem CID | 90459081 |
| Molecular Formula | C13H17BO4 |
| Molecular Weight | 248.09 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-[(1-hydroxy-7-propyl-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one |
| SMILES | CCCc1c(OCC(C)=O)ccc2c1B(O)OC2 |
| InChI | InChI=1S/C13H17BO4/c1-3-4-11-12(17-7-9(2)15)6-5-10-8-18-14(16)13(10)11/h5-6,16H,3-4,7-8H2,1-2H3 |
| InChIKey | NERXBZVOLGUYPY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.09 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|