C10H11BClNO4 — CID 147035571
ethyl N-(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate (PubChem CID 147035571) has the molecular formula C10H11BClNO4 and a molecular weight of 255.47 g/mol. Its IUPAC name is ethyl N-(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate.
| Compound Name | ethyl N-(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate |
|---|---|
| PubChem CID | 147035571 |
| Molecular Formula | C10H11BClNO4 |
| Molecular Weight | 255.47 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | ethyl N-(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(c1Cl)B(O)OC2 |
| InChI | InChI=1S/C10H11BClNO4/c1-2-16-10(14)13-7-4-3-6-5-17-11(15)8(6)9(7)12/h3-4,15H,2,5H2,1H3,(H,13,14) |
| InChIKey | AYKWVNRVYQXMIT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|