C10H11BClNO3S2 — CID 147004257
2-hydroxyethyl N-(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamodithioate (PubChem CID 147004257) has the molecular formula C10H11BClNO3S2 and a molecular weight of 303.60 g/mol. Its IUPAC name is 2-hydroxyethyl N-(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamodithioate.
| Compound Name | 2-hydroxyethyl N-(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamodithioate |
|---|---|
| PubChem CID | 147004257 |
| Molecular Formula | C10H11BClNO3S2 |
| Molecular Weight | 303.60 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 2-hydroxyethyl N-(7-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamodithioate |
| SMILES | OCCSC(=S)Nc1ccc2c(c1Cl)B(O)OC2 |
| InChI | InChI=1S/C10H11BClNO3S2/c12-9-7(13-10(17)18-4-3-14)2-1-6-5-16-11(15)8(6)9/h1-2,14-15H,3-5H2,(H,13,17) |
| InChIKey | ASQCTTXAPLXJFT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.60 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|