C11H13BClNO3S — CID 147675055
O-propyl N-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamothioate (PubChem CID 147675055) has the molecular formula C11H13BClNO3S and a molecular weight of 285.56 g/mol. Its IUPAC name is O-propyl N-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamothioate.
| Compound Name | O-propyl N-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamothioate |
|---|---|
| PubChem CID | 147675055 |
| Molecular Formula | C11H13BClNO3S |
| Molecular Weight | 285.56 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | O-propyl N-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamothioate |
| SMILES | CCCOC(=S)Nc1cc2c(cc1Cl)COB2O |
| InChI | InChI=1S/C11H13BClNO3S/c1-2-3-16-11(18)14-10-5-8-7(4-9(10)13)6-17-12(8)15/h4-5,15H,2-3,6H2,1H3,(H,14,18) |
| InChIKey | GNZRBSRNMZSDPO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.56 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|