C12H14BClO2 — CID 161346504
5-chloro-6-(2-cyclopropylethyl)-1-hydroxy-3H-2,1-benzoxaborole (PubChem CID 161346504) has the molecular formula C12H14BClO2 and a molecular weight of 236.51 g/mol. Its IUPAC name is 5-chloro-6-(2-cyclopropylethyl)-1-hydroxy-3H-2,1-benzoxaborole.
| Compound Name | 5-chloro-6-(2-cyclopropylethyl)-1-hydroxy-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 161346504 |
| Molecular Formula | C12H14BClO2 |
| Molecular Weight | 236.51 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 5-chloro-6-(2-cyclopropylethyl)-1-hydroxy-3H-2,1-benzoxaborole |
| SMILES | OB1OCc2cc(Cl)c(CCC3CC3)cc21 |
| InChI | InChI=1S/C12H14BClO2/c14-12-6-10-7-16-13(15)11(10)5-9(12)4-3-8-1-2-8/h5-6,8,15H,1-4,7H2 |
| InChIKey | WYAIPUOHAKEHJE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|