C15H12BClFNO3 — CID 140829370
N-[2-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-fluorophenyl]acetamide (PubChem CID 140829370) has the molecular formula C15H12BClFNO3 and a molecular weight of 319.53 g/mol. Its IUPAC name is N-[2-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-fluorophenyl]acetamide.
| Compound Name | N-[2-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 140829370 |
| Molecular Formula | C15H12BClFNO3 |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | N-[2-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(F)cc1-c1cc2c(cc1Cl)COB2O |
| InChI | InChI=1S/C15H12BClFNO3/c1-8(20)19-15-3-2-10(18)5-12(15)11-6-13-9(4-14(11)17)7-22-16(13)21/h2-6,21H,7H2,1H3,(H,19,20) |
| InChIKey | VGGYPOLKHYOANK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|