C7H7BFNO2 — CID 130120860
6-fluoro-1-hydroxy-3H-2,1-benzoxaborol-5-amine (PubChem CID 130120860) has the molecular formula C7H7BFNO2 and a molecular weight of 166.95 g/mol. Its IUPAC name is 6-fluoro-1-hydroxy-3H-2,1-benzoxaborol-5-amine.
| Compound Name | 6-fluoro-1-hydroxy-3H-2,1-benzoxaborol-5-amine |
|---|---|
| PubChem CID | 130120860 |
| Molecular Formula | C7H7BFNO2 |
| Molecular Weight | 166.95 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 6-fluoro-1-hydroxy-3H-2,1-benzoxaborol-5-amine |
| SMILES | Nc1cc2c(cc1F)B(O)OC2 |
| InChI | InChI=1S/C7H7BFNO2/c9-6-2-5-4(1-7(6)10)3-12-8(5)11/h1-2,11H,3,10H2 |
| InChIKey | DJTPCRBSQZFGHD-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.95 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|