C17H12BFO4 — CID 140761844
3-phenylprop-2-ynyl 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate (PubChem CID 140761844) has the molecular formula C17H12BFO4 and a molecular weight of 310.09 g/mol. Its IUPAC name is 3-phenylprop-2-ynyl 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate.
| Compound Name | 3-phenylprop-2-ynyl 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate |
|---|---|
| PubChem CID | 140761844 |
| Molecular Formula | C17H12BFO4 |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-phenylprop-2-ynyl 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate |
| SMILES | O=C(OCC#Cc1ccccc1)c1cc2c(cc1F)COB2O |
| InChI | InChI=1S/C17H12BFO4/c19-16-9-13-11-23-18(21)15(13)10-14(16)17(20)22-8-4-7-12-5-2-1-3-6-12/h1-3,5-6,9-10,21H,8,11H2 |
| InChIKey | YNRYXNKDHJHWQM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|