About 3-phenylprop-2-ynyl methylsulfanylformate
3-phenylprop-2-ynyl methylsulfanylformate (PubChem CID 121220624) has the molecular formula C11H10O2S
and a molecular weight of 206.27 g/mol. Its IUPAC name is 3-phenylprop-2-ynyl methylsulfanylformate.
Molecular Properties
| Compound Name | 3-phenylprop-2-ynyl methylsulfanylformate |
| PubChem CID | 121220624 |
| Molecular Formula | C11H10O2S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 3-phenylprop-2-ynyl methylsulfanylformate |
| SMILES | CSC(=O)OCC#Cc1ccccc1 |
| InChI | InChI=1S/C11H10O2S/c1-14-11(12)13-9-5-8-10-6-3-2-4-7-10/h2-4,6-7H,9H2,1H3 |
| InChIKey | HNTMECYLRHJJIS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylprop-2-ynyl methylsulfanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylprop-2-ynyl methylsulfanylformate?
The IUPAC name of 3-phenylprop-2-ynyl methylsulfanylformate (CID 121220624) is 3-phenylprop-2-ynyl methylsulfanylformate.
What is the SMILES notation for 3-phenylprop-2-ynyl methylsulfanylformate?
The canonical SMILES for 3-phenylprop-2-ynyl methylsulfanylformate is CSC(=O)OCC#Cc1ccccc1.
What is the InChIKey of 3-phenylprop-2-ynyl methylsulfanylformate?
The InChIKey is HNTMECYLRHJJIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2S/c1-14-11(12)13-9-5-8-10-6-3-2-4-7-10/h2-4,6-7H,9H2,1H3.
What are the key properties of 3-phenylprop-2-ynyl methylsulfanylformate?
3-phenylprop-2-ynyl methylsulfanylformate has a molecular weight of 206.27 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-2-ynyl methylsulfanylformate is sourced from PubChem (CID 121220624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).