About 3-phenylprop-2-ynyl 2-ethenoxyacetate
3-phenylprop-2-ynyl 2-ethenoxyacetate (PubChem CID 20688866) has the molecular formula C13H12O3
and a molecular weight of 216.24 g/mol. Its IUPAC name is 3-phenylprop-2-ynyl 2-ethenoxyacetate.
Molecular Properties
| Compound Name | 3-phenylprop-2-ynyl 2-ethenoxyacetate |
| PubChem CID | 20688866 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 3-phenylprop-2-ynyl 2-ethenoxyacetate |
| SMILES | C=COCC(=O)OCC#Cc1ccccc1 |
| InChI | InChI=1S/C13H12O3/c1-2-15-11-13(14)16-10-6-9-12-7-4-3-5-8-12/h2-5,7-8H,1,10-11H2 |
| InChIKey | MHBWAGADHFEEMZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylprop-2-ynyl 2-ethenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylprop-2-ynyl 2-ethenoxyacetate?
The IUPAC name of 3-phenylprop-2-ynyl 2-ethenoxyacetate (CID 20688866) is 3-phenylprop-2-ynyl 2-ethenoxyacetate.
What is the SMILES notation for 3-phenylprop-2-ynyl 2-ethenoxyacetate?
The canonical SMILES for 3-phenylprop-2-ynyl 2-ethenoxyacetate is C=COCC(=O)OCC#Cc1ccccc1.
What is the InChIKey of 3-phenylprop-2-ynyl 2-ethenoxyacetate?
The InChIKey is MHBWAGADHFEEMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O3/c1-2-15-11-13(14)16-10-6-9-12-7-4-3-5-8-12/h2-5,7-8H,1,10-11H2.
What are the key properties of 3-phenylprop-2-ynyl 2-ethenoxyacetate?
3-phenylprop-2-ynyl 2-ethenoxyacetate has a molecular weight of 216.24 g/mol, XLogP of 1.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-2-ynyl 2-ethenoxyacetate is sourced from PubChem (CID 20688866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).