About 3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate
3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate (PubChem CID 52666175) has the molecular formula C18H13ClO2
and a molecular weight of 296.75 g/mol. Its IUPAC name is 3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate |
| PubChem CID | 52666175 |
| Molecular Formula | C18H13ClO2 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)OCC#Cc1ccccc1 |
| InChI | InChI=1S/C18H13ClO2/c19-17-10-4-8-16(14-17)11-12-18(20)21-13-5-9-15-6-2-1-3-7-15/h1-4,6-8,10-12,14H,13H2/b12-11+ |
| InChIKey | XEYWJRJRNIXOJQ-VAWYXSNFSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate?
The IUPAC name of 3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate (CID 52666175) is 3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate.
What is the SMILES notation for 3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate?
The canonical SMILES for 3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate is O=C(/C=C/c1cccc(Cl)c1)OCC#Cc1ccccc1.
What is the InChIKey of 3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate?
The InChIKey is XEYWJRJRNIXOJQ-VAWYXSNFSA-N. The full InChI is InChI=1S/C18H13ClO2/c19-17-10-4-8-16(14-17)11-12-18(20)21-13-5-9-15-6-2-1-3-7-15/h1-4,6-8,10-12,14H,13H2/b12-11+.
What are the key properties of 3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate?
3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate has a molecular weight of 296.75 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-2-ynyl (E)-3-(3-chlorophenyl)prop-2-enoate is sourced from PubChem (CID 52666175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).