C15H9Cl3O2 — CID 7959568
(3,4-dichlorophenyl) (E)-3-(3-chlorophenyl)prop-2-enoate (PubChem CID 7959568) has the molecular formula C15H9Cl3O2 and a molecular weight of 327.59 g/mol. Its IUPAC name is (3,4-dichlorophenyl) (E)-3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | (3,4-dichlorophenyl) (E)-3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7959568 |
| Molecular Formula | C15H9Cl3O2 |
| Molecular Weight | 327.59 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | (3,4-dichlorophenyl) (E)-3-(3-chlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl3O2/c16-11-3-1-2-10(8-11)4-7-15(19)20-12-5-6-13(17)14(18)9-12/h1-9H/b7-4+ |
| InChIKey | RZNLHOGUXUFVMQ-QPJJXVBHSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|