C18H13Cl3O3 — CID 2479775
[(2S)-1-(3-chlorophenyl)-1-oxopropan-2-yl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 2479775) has the molecular formula C18H13Cl3O3 and a molecular weight of 383.66 g/mol. Its IUPAC name is [(2S)-1-(3-chlorophenyl)-1-oxopropan-2-yl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(3-chlorophenyl)-1-oxopropan-2-yl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2479775 |
| Molecular Formula | C18H13Cl3O3 |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | [(2S)-1-(3-chlorophenyl)-1-oxopropan-2-yl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc(Cl)c(Cl)c1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H13Cl3O3/c1-11(18(23)13-3-2-4-14(19)10-13)24-17(22)8-6-12-5-7-15(20)16(21)9-12/h2-11H,1H3/b8-6+/t11-/m0/s1 |
| InChIKey | FBJOFLQNGVEWSB-IOCXFXADSA-N |
| XLogP | 5.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|