C18H14Cl2FNO3 — CID 7709593
[(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 7709593) has the molecular formula C18H14Cl2FNO3 and a molecular weight of 382.22 g/mol. Its IUPAC name is [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7709593 |
| Molecular Formula | C18H14Cl2FNO3 |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc(Cl)c(Cl)c1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H14Cl2FNO3/c1-11(18(24)22-14-6-4-13(21)5-7-14)25-17(23)9-3-12-2-8-15(19)16(20)10-12/h2-11H,1H3,(H,22,24)/b9-3+/t11-/m0/s1 |
| InChIKey | UHNPSWQKWHXRDK-BWLWAFFFSA-N |
| XLogP | 4.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|