C19H16Cl3NO3 — CID 3591776
[1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl] 3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 3591776) has the molecular formula C19H16Cl3NO3 and a molecular weight of 412.70 g/mol. Its IUPAC name is [1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl] 3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl] 3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3591776 |
| Molecular Formula | C19H16Cl3NO3 |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | [1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl] 3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | Cc1ccc(NC(=O)C(C)OC(=O)C=Cc2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C19H16Cl3NO3/c1-11-3-6-14(10-16(11)21)23-19(25)12(2)26-18(24)8-5-13-4-7-15(20)17(22)9-13/h3-10,12H,1-2H3,(H,23,25) |
| InChIKey | SFPOSRXLVWSBKD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|