About 3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate
3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 70561618) has the molecular formula C12H8ClIO2
and a molecular weight of 346.55 g/mol. Its IUPAC name is 3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| PubChem CID | 70561618 |
| Molecular Formula | C12H8ClIO2 |
| Molecular Weight | 346.55 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | 3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)OCC#CI |
| InChI | InChI=1S/C12H8ClIO2/c13-11-5-2-10(3-6-11)4-7-12(15)16-9-1-8-14/h2-7H,9H2/b7-4+ |
| InChIKey | KXFYXLGNBTXRHM-QPJJXVBHSA-N |
| XLogP | 3.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate?
The IUPAC name of 3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate (CID 70561618) is 3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate.
What is the SMILES notation for 3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate?
The canonical SMILES for 3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate is O=C(/C=C/c1ccc(Cl)cc1)OCC#CI.
What is the InChIKey of 3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate?
The InChIKey is KXFYXLGNBTXRHM-QPJJXVBHSA-N. The full InChI is InChI=1S/C12H8ClIO2/c13-11-5-2-10(3-6-11)4-7-12(15)16-9-1-8-14/h2-7H,9H2/b7-4+.
What are the key properties of 3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate?
3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate has a molecular weight of 346.55 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodoprop-2-ynyl (E)-3-(4-chlorophenyl)prop-2-enoate is sourced from PubChem (CID 70561618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).