About 3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate
3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 101432870) has the molecular formula C13H13ClO3
and a molecular weight of 252.70 g/mol. Its IUPAC name is 3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| PubChem CID | 101432870 |
| Molecular Formula | C13H13ClO3 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | CC(=O)CCOC(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H13ClO3/c1-10(15)8-9-17-13(16)7-4-11-2-5-12(14)6-3-11/h2-7H,8-9H2,1H3/b7-4+ |
| InChIKey | GPHNDNDQQBRBGV-QPJJXVBHSA-N |
| XLogP | 2.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate?
The IUPAC name of 3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate (CID 101432870) is 3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate.
What is the SMILES notation for 3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate?
The canonical SMILES for 3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate is CC(=O)CCOC(=O)/C=C/c1ccc(Cl)cc1.
What is the InChIKey of 3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate?
The InChIKey is GPHNDNDQQBRBGV-QPJJXVBHSA-N. The full InChI is InChI=1S/C13H13ClO3/c1-10(15)8-9-17-13(16)7-4-11-2-5-12(14)6-3-11/h2-7H,8-9H2,1H3/b7-4+.
What are the key properties of 3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate?
3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate has a molecular weight of 252.70 g/mol, XLogP of 2.88, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutyl (E)-3-(4-chlorophenyl)prop-2-enoate is sourced from PubChem (CID 101432870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).