C21H17ClO4 — CID 24773322
[5-(3-chlorophenyl)-6-oxo-2,3-dihydropyran-2-yl]methyl (E)-3-phenylprop-2-enoate (PubChem CID 24773322) has the molecular formula C21H17ClO4 and a molecular weight of 368.82 g/mol. Its IUPAC name is [5-(3-chlorophenyl)-6-oxo-2,3-dihydropyran-2-yl]methyl (E)-3-phenylprop-2-enoate.
| Compound Name | [5-(3-chlorophenyl)-6-oxo-2,3-dihydropyran-2-yl]methyl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 24773322 |
| Molecular Formula | C21H17ClO4 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | [5-(3-chlorophenyl)-6-oxo-2,3-dihydropyran-2-yl]methyl (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OCC1CC=C(c2cccc(Cl)c2)C(=O)O1 |
| InChI | InChI=1S/C21H17ClO4/c22-17-8-4-7-16(13-17)19-11-10-18(26-21(19)24)14-25-20(23)12-9-15-5-2-1-3-6-15/h1-9,11-13,18H,10,14H2/b12-9+ |
| InChIKey | ZXMRYAFSNIDFTD-FMIVXFBMSA-N |
| XLogP | 4.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|