C9H10B2O3 — CID 59420255
1-hydroxy-5-methyl-3,7-dihydrooxaborolo[3,4-f][2,1]benzoxaborole (PubChem CID 59420255) has the molecular formula C9H10B2O3 and a molecular weight of 187.80 g/mol. Its IUPAC name is 1-hydroxy-5-methyl-3,7-dihydrooxaborolo[3,4-f][2,1]benzoxaborole.
| Compound Name | 1-hydroxy-5-methyl-3,7-dihydrooxaborolo[3,4-f][2,1]benzoxaborole |
|---|---|
| PubChem CID | 59420255 |
| Molecular Formula | C9H10B2O3 |
| Molecular Weight | 187.80 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 1-hydroxy-5-methyl-3,7-dihydrooxaborolo[3,4-f][2,1]benzoxaborole |
| SMILES | CB1OCc2cc3c(cc21)COB3O |
| InChI | InChI=1S/C9H10B2O3/c1-10-8-2-7-5-14-11(12)9(7)3-6(8)4-13-10/h2-3,12H,4-5H2,1H3 |
| InChIKey | WDLJXYFGEGLNIS-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.80 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|