C9H11BO2 — CID 146884186
(1-methyl-3H-2,1-benzoxaborol-6-yl)methanol (PubChem CID 146884186) has the molecular formula C9H11BO2 and a molecular weight of 162.00 g/mol. Its IUPAC name is (1-methyl-3H-2,1-benzoxaborol-6-yl)methanol.
| Compound Name | (1-methyl-3H-2,1-benzoxaborol-6-yl)methanol |
|---|---|
| PubChem CID | 146884186 |
| Molecular Formula | C9H11BO2 |
| Molecular Weight | 162.00 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (1-methyl-3H-2,1-benzoxaborol-6-yl)methanol |
| SMILES | CB1OCc2ccc(CO)cc21 |
| InChI | InChI=1S/C9H11BO2/c1-10-9-4-7(5-11)2-3-8(9)6-12-10/h2-4,11H,5-6H2,1H3 |
| InChIKey | SUVJYQNBIIWYFQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.00 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|