C17H13BN2O — CID 167596794
5-[(3,4-diisocyanophenyl)methyl]-1-methyl-3H-2,1-benzoxaborole (PubChem CID 167596794) has the molecular formula C17H13BN2O and a molecular weight of 272.12 g/mol. Its IUPAC name is 5-[(3,4-diisocyanophenyl)methyl]-1-methyl-3H-2,1-benzoxaborole.
| Compound Name | 5-[(3,4-diisocyanophenyl)methyl]-1-methyl-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 167596794 |
| Molecular Formula | C17H13BN2O |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 5-[(3,4-diisocyanophenyl)methyl]-1-methyl-3H-2,1-benzoxaborole |
| SMILES | [C-]#[N+]c1ccc(Cc2ccc3c(c2)COB3C)cc1[N+]#[C-] |
| InChI | InChI=1S/C17H13BN2O/c1-18-15-6-4-12(9-14(15)11-21-18)8-13-5-7-16(19-2)17(10-13)20-3/h4-7,9-10H,8,11H2,1H3 |
| InChIKey | LXPVABBJMPIUMN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 17.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|