C18H18BNO2 — CID 58079890
5-(4-isocyano-2,5-dimethylphenoxy)-1,4-dimethyl-3H-2,1-benzoxaborole (PubChem CID 58079890) has the molecular formula C18H18BNO2 and a molecular weight of 291.16 g/mol. Its IUPAC name is 5-(4-isocyano-2,5-dimethylphenoxy)-1,4-dimethyl-3H-2,1-benzoxaborole.
| Compound Name | 5-(4-isocyano-2,5-dimethylphenoxy)-1,4-dimethyl-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 58079890 |
| Molecular Formula | C18H18BNO2 |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 5-(4-isocyano-2,5-dimethylphenoxy)-1,4-dimethyl-3H-2,1-benzoxaborole |
| SMILES | [C-]#[N+]c1cc(C)c(Oc2ccc3c(c2C)COB3C)cc1C |
| InChI | InChI=1S/C18H18BNO2/c1-11-9-18(12(2)8-16(11)20-5)22-17-7-6-15-14(13(17)3)10-21-19(15)4/h6-9H,10H2,1-4H3 |
| InChIKey | BRUYHPXTCRYMQG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|