C18H18BNO3 — CID 159890983
3-deuterio-1-hydroxy-5-(4-isocyano-3,5-dimethylphenoxy)-3,4-dimethyl-2,1-benzoxaborole (PubChem CID 159890983) has the molecular formula C18H18BNO3 and a molecular weight of 308.16 g/mol. Its IUPAC name is 3-deuterio-1-hydroxy-5-(4-isocyano-3,5-dimethylphenoxy)-3,4-dimethyl-2,1-benzoxaborole.
| Compound Name | 3-deuterio-1-hydroxy-5-(4-isocyano-3,5-dimethylphenoxy)-3,4-dimethyl-2,1-benzoxaborole |
|---|---|
| PubChem CID | 159890983 |
| Molecular Formula | C18H18BNO3 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3-deuterio-1-hydroxy-5-(4-isocyano-3,5-dimethylphenoxy)-3,4-dimethyl-2,1-benzoxaborole |
| SMILES | [2H]C1(C)OB(O)c2ccc(Oc3cc(C)c([N+]#[C-])c(C)c3)c(C)c21 |
| InChI | InChI=1S/C18H18BNO3/c1-10-8-14(9-11(2)18(10)20-5)22-16-7-6-15-17(12(16)3)13(4)23-19(15)21/h6-9,13,21H,1-4H3/i13D |
| InChIKey | MEPYHPNGIXHAJZ-YSOHJTORSA-N |
| XLogP | 3.73 |
| TPSA | 43.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|