C17H16BNO3 — CID 58079984
3,3-dideuterio-1-hydroxy-5-(4-isocyano-3,5-dimethylphenoxy)-6-methyl-2,1-benzoxaborole (PubChem CID 58079984) has the molecular formula C17H16BNO3 and a molecular weight of 295.14 g/mol. Its IUPAC name is 3,3-dideuterio-1-hydroxy-5-(4-isocyano-3,5-dimethylphenoxy)-6-methyl-2,1-benzoxaborole.
| Compound Name | 3,3-dideuterio-1-hydroxy-5-(4-isocyano-3,5-dimethylphenoxy)-6-methyl-2,1-benzoxaborole |
|---|---|
| PubChem CID | 58079984 |
| Molecular Formula | C17H16BNO3 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 3,3-dideuterio-1-hydroxy-5-(4-isocyano-3,5-dimethylphenoxy)-6-methyl-2,1-benzoxaborole |
| SMILES | [2H]C1([2H])OB(O)c2cc(C)c(Oc3cc(C)c([N+]#[C-])c(C)c3)cc21 |
| InChI | InChI=1S/C17H16BNO3/c1-10-7-15-13(9-21-18(15)20)8-16(10)22-14-5-11(2)17(19-4)12(3)6-14/h5-8,20H,9H2,1-3H3/i9D2 |
| InChIKey | URDFFVNTDZRIRC-KNXIQCGSSA-N |
| XLogP | 3.17 |
| TPSA | 43.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|