C15H12BClN2O3 — CID 58080000
3-chloro-2-[(1-hydroxy-6-methyl-3H-2,1-benzoxaborol-5-yl)oxy]-5-isocyano-6-methylpyridine (PubChem CID 58080000) has the molecular formula C15H12BClN2O3 and a molecular weight of 314.54 g/mol. Its IUPAC name is 3-chloro-2-[(1-hydroxy-6-methyl-3H-2,1-benzoxaborol-5-yl)oxy]-5-isocyano-6-methylpyridine.
| Compound Name | 3-chloro-2-[(1-hydroxy-6-methyl-3H-2,1-benzoxaborol-5-yl)oxy]-5-isocyano-6-methylpyridine |
|---|---|
| PubChem CID | 58080000 |
| Molecular Formula | C15H12BClN2O3 |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 3-chloro-2-[(1-hydroxy-6-methyl-3H-2,1-benzoxaborol-5-yl)oxy]-5-isocyano-6-methylpyridine |
| SMILES | [C-]#[N+]c1cc(Cl)c(Oc2cc3c(cc2C)B(O)OC3)nc1C |
| InChI | InChI=1S/C15H12BClN2O3/c1-8-4-11-10(7-21-16(11)20)5-14(8)22-15-12(17)6-13(18-3)9(2)19-15/h4-6,20H,7H2,1-2H3 |
| InChIKey | XIOMVHYIGGZMKN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|