C16H14BNO2 — CID 88865501
5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole (PubChem CID 88865501) has the molecular formula C16H14BNO2 and a molecular weight of 263.10 g/mol. Its IUPAC name is 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole.
| Compound Name | 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 88865501 |
| Molecular Formula | C16H14BNO2 |
| Molecular Weight | 263.10 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole |
| SMILES | [C-]#[N+]c1ccc(Oc2cc3c(cc2C)B(C)OC3)cc1 |
| InChI | InChI=1S/C16H14BNO2/c1-11-8-15-12(10-19-17(15)2)9-16(11)20-14-6-4-13(18-3)5-7-14/h4-9H,10H2,1-2H3 |
| InChIKey | DFTMZWVCKXPGMQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.10 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|