About 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole
5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole (PubChem CID 88865501) has the molecular formula C16H14BNO2
and a molecular weight of 263.10 g/mol. Its IUPAC name is 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole.
Molecular Properties
| Compound Name | 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole |
| PubChem CID | 88865501 |
| Molecular Formula | C16H14BNO2 |
| Molecular Weight | 263.10 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole |
| SMILES | [C-]#[N+]c1ccc(Oc2cc3c(cc2C)B(C)OC3)cc1 |
| InChI | InChI=1S/C16H14BNO2/c1-11-8-15-12(10-19-17(15)2)9-16(11)20-14-6-4-13(18-3)5-7-14/h4-9H,10H2,1-2H3 |
| InChIKey | DFTMZWVCKXPGMQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.10 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole?
The IUPAC name of 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole (CID 88865501) is 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole.
What is the SMILES notation for 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole?
The canonical SMILES for 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole is [C-]#[N+]c1ccc(Oc2cc3c(cc2C)B(C)OC3)cc1.
What is the InChIKey of 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole?
The InChIKey is DFTMZWVCKXPGMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BNO2/c1-11-8-15-12(10-19-17(15)2)9-16(11)20-14-6-4-13(18-3)5-7-14/h4-9H,10H2,1-2H3.
What are the key properties of 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole?
5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole has a molecular weight of 263.10 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-isocyanophenoxy)-1,6-dimethyl-3H-2,1-benzoxaborole is sourced from PubChem (CID 88865501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).