C28H21B2ClN2O6 — CID 158117231
[2-(chloromethyl)-4-(4-isocyanophenoxy)phenyl]boronic acid;1-hydroxy-5-(4-isocyanophenoxy)-3H-2,1-benzoxaborole (PubChem CID 158117231) has the molecular formula C28H21B2ClN2O6 and a molecular weight of 538.56 g/mol. Its IUPAC name is [2-(chloromethyl)-4-(4-isocyanophenoxy)phenyl]boronic acid;1-hydroxy-5-(4-isocyanophenoxy)-3H-2,1-benzoxaborole.
| Compound Name | [2-(chloromethyl)-4-(4-isocyanophenoxy)phenyl]boronic acid;1-hydroxy-5-(4-isocyanophenoxy)-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 158117231 |
| Molecular Formula | C28H21B2ClN2O6 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | [2-(chloromethyl)-4-(4-isocyanophenoxy)phenyl]boronic acid;1-hydroxy-5-(4-isocyanophenoxy)-3H-2,1-benzoxaborole |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc(B(O)O)c(CCl)c2)cc1.[C-]#[N+]c1ccc(Oc2ccc3c(c2)COB3O)cc1 |
| InChI | InChI=1S/C14H11BClNO3.C14H10BNO3/c1-17-11-2-4-12(5-3-11)20-13-6-7-14(15(18)19)10(8-13)9-16;1-16-11-2-4-12(5-3-11)19-13-6-7-14-10(8-13)9-18-15(14)17/h2-8,18-19H,9H2;2-8,17H,9H2 |
| InChIKey | FRDVQEVYSGSSHO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|