C14H11BClNO3 — CID 155775187
[2-(chloromethyl)-4-(4-cyanophenoxy)phenyl]boronic acid (PubChem CID 155775187) has the molecular formula C14H11BClNO3 and a molecular weight of 287.51 g/mol. Its IUPAC name is [2-(chloromethyl)-4-(4-cyanophenoxy)phenyl]boronic acid.
| Compound Name | [2-(chloromethyl)-4-(4-cyanophenoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 155775187 |
| Molecular Formula | C14H11BClNO3 |
| Molecular Weight | 287.51 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | [2-(chloromethyl)-4-(4-cyanophenoxy)phenyl]boronic acid |
| SMILES | N#Cc1ccc(Oc2ccc(B(O)O)c(CCl)c2)cc1 |
| InChI | InChI=1S/C14H11BClNO3/c16-8-11-7-13(5-6-14(11)15(18)19)20-12-3-1-10(9-17)2-4-12/h1-7,18-19H,8H2 |
| InChIKey | SDMVZMZQWCHYKU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|