C14H12BNO4 — CID 162372196
4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzonitrile;hydrate (PubChem CID 162372196) has the molecular formula C14H12BNO4 and a molecular weight of 269.07 g/mol. Its IUPAC name is 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzonitrile;hydrate.
| Compound Name | 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzonitrile;hydrate |
|---|---|
| PubChem CID | 162372196 |
| Molecular Formula | C14H12BNO4 |
| Molecular Weight | 269.07 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzonitrile;hydrate |
| SMILES | N#Cc1ccc(Oc2ccc3c(c2)COB3O)cc1.O |
| InChI | InChI=1S/C14H10BNO3.H2O/c16-8-10-1-3-12(4-2-10)19-13-5-6-14-11(7-13)9-18-15(14)17;/h1-7,17H,9H2;1H2 |
| InChIKey | OSZGWAAHVSRMON-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.07 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|