C14H11BN2O3 — CID 58080016
2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-methylpyridine-3-carbonitrile (PubChem CID 58080016) has the molecular formula C14H11BN2O3 and a molecular weight of 266.06 g/mol. Its IUPAC name is 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 58080016 |
| Molecular Formula | C14H11BN2O3 |
| Molecular Weight | 266.06 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-methylpyridine-3-carbonitrile |
| SMILES | Cc1ccc(C#N)c(Oc2ccc3c(c2)COB3O)n1 |
| InChI | InChI=1S/C14H11BN2O3/c1-9-2-3-10(7-16)14(17-9)20-12-4-5-13-11(6-12)8-19-15(13)18/h2-6,18H,8H2,1H3 |
| InChIKey | LLKXMXHTBVUWNU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.06 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|