C15H10BN3O2 — CID 58080043
6-isocyano-2-[(1-methyl-3H-2,1-benzoxaborol-5-yl)oxy]pyridine-3-carbonitrile (PubChem CID 58080043) has the molecular formula C15H10BN3O2 and a molecular weight of 275.08 g/mol. Its IUPAC name is 6-isocyano-2-[(1-methyl-3H-2,1-benzoxaborol-5-yl)oxy]pyridine-3-carbonitrile.
| Compound Name | 6-isocyano-2-[(1-methyl-3H-2,1-benzoxaborol-5-yl)oxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 58080043 |
| Molecular Formula | C15H10BN3O2 |
| Molecular Weight | 275.08 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 6-isocyano-2-[(1-methyl-3H-2,1-benzoxaborol-5-yl)oxy]pyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc(C#N)c(Oc2ccc3c(c2)COB3C)n1 |
| InChI | InChI=1S/C15H10BN3O2/c1-16-13-5-4-12(7-11(13)9-20-16)21-15-10(8-17)3-6-14(18-2)19-15/h3-7H,9H2,1H3 |
| InChIKey | AUIVTKSTWNZWIR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.08 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|