C19H18BN3O5 — CID 66726512
2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(2-propan-2-yloxyethoxy)pyridine-3,5-dicarbonitrile (PubChem CID 66726512) has the molecular formula C19H18BN3O5 and a molecular weight of 379.18 g/mol. Its IUPAC name is 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(2-propan-2-yloxyethoxy)pyridine-3,5-dicarbonitrile.
| Compound Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(2-propan-2-yloxyethoxy)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 66726512 |
| Molecular Formula | C19H18BN3O5 |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(2-propan-2-yloxyethoxy)pyridine-3,5-dicarbonitrile |
| SMILES | CC(C)OCCOc1nc(Oc2ccc3c(c2)COB3O)c(C#N)cc1C#N |
| InChI | InChI=1S/C19H18BN3O5/c1-12(2)25-5-6-26-18-13(9-21)7-14(10-22)19(23-18)28-16-3-4-17-15(8-16)11-27-20(17)24/h3-4,7-8,12,24H,5-6,11H2,1-2H3 |
| InChIKey | VUKLRTNDLAMXGZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|