C17H18BN3O4 — CID 68796062
6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(3-methoxypropylamino)pyridine-3-carbonitrile (PubChem CID 68796062) has the molecular formula C17H18BN3O4 and a molecular weight of 339.16 g/mol. Its IUPAC name is 6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(3-methoxypropylamino)pyridine-3-carbonitrile.
| Compound Name | 6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(3-methoxypropylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 68796062 |
| Molecular Formula | C17H18BN3O4 |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(3-methoxypropylamino)pyridine-3-carbonitrile |
| SMILES | COCCCNc1nc(Oc2ccc3c(c2)COB3O)ccc1C#N |
| InChI | InChI=1S/C17H18BN3O4/c1-23-8-2-7-20-17-12(10-19)3-6-16(21-17)25-14-4-5-15-13(9-14)11-24-18(15)22/h3-6,9,22H,2,7-8,11H2,1H3,(H,20,21) |
| InChIKey | ITFBZFYKSOTNNB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|