C18H20BN3O3 — CID 46184479
6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]-2-pentoxypyridine-3-carbonitrile (PubChem CID 46184479) has the molecular formula C18H20BN3O3 and a molecular weight of 337.19 g/mol. Its IUPAC name is 6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]-2-pentoxypyridine-3-carbonitrile.
| Compound Name | 6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]-2-pentoxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 46184479 |
| Molecular Formula | C18H20BN3O3 |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]-2-pentoxypyridine-3-carbonitrile |
| SMILES | CCCCCOc1nc(Nc2ccc3c(c2)COB3O)ccc1C#N |
| InChI | InChI=1S/C18H20BN3O3/c1-2-3-4-9-24-18-13(11-20)5-8-17(22-18)21-15-6-7-16-14(10-15)12-25-19(16)23/h5-8,10,23H,2-4,9,12H2,1H3,(H,21,22) |
| InChIKey | OATLQJDCBODMSW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|