C18H20BN3O2 — CID 58333179
6-butoxy-5-isocyano-N-(1-methyl-3H-2,1-benzoxaborol-5-yl)pyridin-2-amine (PubChem CID 58333179) has the molecular formula C18H20BN3O2 and a molecular weight of 321.19 g/mol. Its IUPAC name is 6-butoxy-5-isocyano-N-(1-methyl-3H-2,1-benzoxaborol-5-yl)pyridin-2-amine.
| Compound Name | 6-butoxy-5-isocyano-N-(1-methyl-3H-2,1-benzoxaborol-5-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 58333179 |
| Molecular Formula | C18H20BN3O2 |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 6-butoxy-5-isocyano-N-(1-methyl-3H-2,1-benzoxaborol-5-yl)pyridin-2-amine |
| SMILES | [C-]#[N+]c1ccc(Nc2ccc3c(c2)COB3C)nc1OCCCC |
| InChI | InChI=1S/C18H20BN3O2/c1-4-5-10-23-18-16(20-3)8-9-17(22-18)21-14-6-7-15-13(11-14)12-24-19(15)2/h6-9,11H,4-5,10,12H2,1-2H3,(H,21,22) |
| InChIKey | SZFOEDLAKISHTG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 47.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|