C21H22BN3O2 — CID 167621358
3-[[5-[(3,4-diisocyanophenyl)methyl]-3H-2,1-benzoxaborol-1-yl]oxy]-N,N-dimethylpropan-1-amine (PubChem CID 167621358) has the molecular formula C21H22BN3O2 and a molecular weight of 359.24 g/mol. Its IUPAC name is 3-[[5-[(3,4-diisocyanophenyl)methyl]-3H-2,1-benzoxaborol-1-yl]oxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[[5-[(3,4-diisocyanophenyl)methyl]-3H-2,1-benzoxaborol-1-yl]oxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 167621358 |
| Molecular Formula | C21H22BN3O2 |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-[[5-[(3,4-diisocyanophenyl)methyl]-3H-2,1-benzoxaborol-1-yl]oxy]-N,N-dimethylpropan-1-amine |
| SMILES | [C-]#[N+]c1ccc(Cc2ccc3c(c2)COB3OCCCN(C)C)cc1[N+]#[C-] |
| InChI | InChI=1S/C21H22BN3O2/c1-23-20-9-7-17(14-21(20)24-2)12-16-6-8-19-18(13-16)15-27-22(19)26-11-5-10-25(3)4/h6-9,13-14H,5,10-12,15H2,3-4H3 |
| InChIKey | VFBAUPLIDYXMDD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 30.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|