C14H16BFN4O2 — CID 155572746
5-fluoro-2-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-4-N-propylpyrimidine-2,4-diamine (PubChem CID 155572746) has the molecular formula C14H16BFN4O2 and a molecular weight of 302.12 g/mol. Its IUPAC name is 5-fluoro-2-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-4-N-propylpyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-4-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155572746 |
| Molecular Formula | C14H16BFN4O2 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 5-fluoro-2-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-4-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1nc(Nc2ccc3c(c2)COB3O)ncc1F |
| InChI | InChI=1S/C14H16BFN4O2/c1-2-5-17-13-12(16)7-18-14(20-13)19-10-3-4-11-9(6-10)8-22-15(11)21/h3-4,6-7,21H,2,5,8H2,1H3,(H2,17,18,19,20) |
| InChIKey | XYEAULILFIJYJX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|