C17H17BClN5O3 — CID 171441485
(3R,4S)-3-[[5-chloro-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]pyrimidin-4-yl]amino]oxane-4-carbonitrile (PubChem CID 171441485) has the molecular formula C17H17BClN5O3 and a molecular weight of 385.62 g/mol. Its IUPAC name is (3R,4S)-3-[[5-chloro-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]pyrimidin-4-yl]amino]oxane-4-carbonitrile.
| Compound Name | (3R,4S)-3-[[5-chloro-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]pyrimidin-4-yl]amino]oxane-4-carbonitrile |
|---|---|
| PubChem CID | 171441485 |
| Molecular Formula | C17H17BClN5O3 |
| Molecular Weight | 385.62 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (3R,4S)-3-[[5-chloro-2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]pyrimidin-4-yl]amino]oxane-4-carbonitrile |
| SMILES | N#C[C@H]1CCOC[C@@H]1Nc1nc(Nc2ccc3c(c2)COB3O)ncc1Cl |
| InChI | InChI=1S/C17H17BClN5O3/c19-14-7-21-17(22-12-1-2-13-11(5-12)8-27-18(13)25)24-16(14)23-15-9-26-4-3-10(15)6-20/h1-2,5,7,10,15,25H,3-4,8-9H2,(H2,21,22,23,24)/t10-,15+/m1/s1 |
| InChIKey | UPJGQYJLIPKARY-BMIGLBTASA-N |
| XLogP | 1.43 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.62 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|