C18H20BN5O3 — CID 171902409
(4R)-3-[[2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]-5-methylpyrimidin-4-yl]amino]oxane-4-carbonitrile (PubChem CID 171902409) has the molecular formula C18H20BN5O3 and a molecular weight of 365.20 g/mol. Its IUPAC name is (4R)-3-[[2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]-5-methylpyrimidin-4-yl]amino]oxane-4-carbonitrile.
| Compound Name | (4R)-3-[[2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]-5-methylpyrimidin-4-yl]amino]oxane-4-carbonitrile |
|---|---|
| PubChem CID | 171902409 |
| Molecular Formula | C18H20BN5O3 |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (4R)-3-[[2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]-5-methylpyrimidin-4-yl]amino]oxane-4-carbonitrile |
| SMILES | Cc1cnc(Nc2ccc3c(c2)COB3O)nc1NC1COCC[C@H]1C#N |
| InChI | InChI=1S/C18H20BN5O3/c1-11-8-21-18(22-14-2-3-15-13(6-14)9-27-19(15)25)24-17(11)23-16-10-26-5-4-12(16)7-20/h2-3,6,8,12,16,25H,4-5,9-10H2,1H3,(H2,21,22,23,24)/t12-,16?/m0/s1 |
| InChIKey | GULMRSPJXOFPIF-HKALDPMFSA-N |
| XLogP | 1.09 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|