C19H18BFN4O2 — CID 155572768
4-N-[(4-fluorophenyl)methyl]-2-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-methylpyrimidine-2,4-diamine (PubChem CID 155572768) has the molecular formula C19H18BFN4O2 and a molecular weight of 364.19 g/mol. Its IUPAC name is 4-N-[(4-fluorophenyl)methyl]-2-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[(4-fluorophenyl)methyl]-2-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155572768 |
| Molecular Formula | C19H18BFN4O2 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-N-[(4-fluorophenyl)methyl]-2-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-methylpyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2ccc3c(c2)COB3O)nc1NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H18BFN4O2/c1-12-9-23-19(24-16-6-7-17-14(8-16)11-27-20(17)26)25-18(12)22-10-13-2-4-15(21)5-3-13/h2-9,26H,10-11H2,1H3,(H2,22,23,24,25) |
| InChIKey | XOCZMQGWSDWVGV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|