C21H20BN5O3 — CID 175090668
N-[3-[[4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]-5-methylpyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 175090668) has the molecular formula C21H20BN5O3 and a molecular weight of 401.24 g/mol. Its IUPAC name is N-[3-[[4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]-5-methylpyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]-5-methylpyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175090668 |
| Molecular Formula | C21H20BN5O3 |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-[3-[[4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)amino]-5-methylpyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2ncc(C)c(Nc3ccc4c(c3)B(O)OC4)n2)c1 |
| InChI | InChI=1S/C21H20BN5O3/c1-3-19(28)24-15-5-4-6-16(9-15)26-21-23-11-13(2)20(27-21)25-17-8-7-14-12-30-22(29)18(14)10-17/h3-11,29H,1,12H2,2H3,(H,24,28)(H2,23,25,26,27) |
| InChIKey | HLIDCISBZVBLGO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|