C25H27N7O2 — CID 158243464
N-[3-[[2-[[(4aS)-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-5-methylpyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 158243464) has the molecular formula C25H27N7O2 and a molecular weight of 457.54 g/mol. Its IUPAC name is N-[3-[[2-[[(4aS)-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-5-methylpyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[[(4aS)-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-5-methylpyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 158243464 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[3-[[2-[[(4aS)-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-5-methylpyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc4c(c3)OC[C@@H]3CNCCN43)ncc2C)c1 |
| InChI | InChI=1S/C25H27N7O2/c1-3-23(33)28-17-5-4-6-18(11-17)29-24-16(2)13-27-25(31-24)30-19-7-8-21-22(12-19)34-15-20-14-26-9-10-32(20)21/h3-8,11-13,20,26H,1,9-10,14-15H2,2H3,(H,28,33)(H2,27,29,30,31)/t20-/m0/s1 |
| InChIKey | OEOAUDWSDDYFBA-FQEVSTJZSA-N |
| XLogP | 3.57 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|